C13H17N3O4 — CID 162338446
acetic acid;5-[3-(aminomethyl)phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 162338446) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is acetic acid;5-[3-(aminomethyl)phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | acetic acid;5-[3-(aminomethyl)phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162338446 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | acetic acid;5-[3-(aminomethyl)phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC(=O)O.CC1(c2cccc(CN)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C11H13N3O2.C2H4O2/c1-11(9(15)13-10(16)14-11)8-4-2-3-7(5-8)6-12;1-2(3)4/h2-5H,6,12H2,1H3,(H2,13,14,15,16);1H3,(H,3,4) |
| InChIKey | ZVBYFFWNHGCODX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|