About 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid
2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid (PubChem CID 120513707) has the molecular formula C14H15N3O5
and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid |
| PubChem CID | 120513707 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1cccc(C2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C14H15N3O5/c1-14(12(21)15-13(22)16-14)9-5-3-4-8(6-9)11(20)17(2)7-10(18)19/h3-6H,7H2,1-2H3,(H,18,19)(H2,15,16,21,22) |
| InChIKey | RVSGFVQDEXDZEF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid?
The IUPAC name of 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid (CID 120513707) is 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid.
What is the SMILES notation for 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid?
The canonical SMILES for 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid is CN(CC(=O)O)C(=O)c1cccc(C2(C)NC(=O)NC2=O)c1.
What is the InChIKey of 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid?
The InChIKey is RVSGFVQDEXDZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O5/c1-14(12(21)15-13(22)16-14)9-5-3-4-8(6-9)11(20)17(2)7-10(18)19/h3-6H,7H2,1-2H3,(H,18,19)(H2,15,16,21,22).
What are the key properties of 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid?
2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid has a molecular weight of 305.29 g/mol, XLogP of -0.10, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid is sourced from PubChem (CID 120513707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).