C14H15N3O5 — CID 120513707
2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid (PubChem CID 120513707) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 120513707 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[methyl-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1cccc(C2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C14H15N3O5/c1-14(12(21)15-13(22)16-14)9-5-3-4-8(6-9)11(20)17(2)7-10(18)19/h3-6H,7H2,1-2H3,(H,18,19)(H2,15,16,21,22) |
| InChIKey | RVSGFVQDEXDZEF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|