C16H19N3O4 — CID 138044244
3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 138044244) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 138044244 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC1(c2cccc(C(=O)NCC3CCCO3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H19N3O4/c1-16(14(21)18-15(22)19-16)11-5-2-4-10(8-11)13(20)17-9-12-6-3-7-23-12/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,17,20)(H2,18,19,21,22) |
| InChIKey | PWPKYGDVXDTMAV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|