C28H28N4O3 — CID 70134938
3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 70134938) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 70134938 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C28H28N4O3/c29-27-31-28(22-11-3-1-4-12-22,23-13-5-2-6-14-23)26(34)32(27)19-20-9-7-10-21(17-20)25(33)30-18-24-15-8-16-35-24/h1-7,9-14,17,24H,8,15-16,18-19H2,(H2,29,31)(H,30,33) |
| InChIKey | ITICWVUXVQSMOZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |