C12H16N2O6S2 — CID 155962510
2-[[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylbenzoyl]-methylamino]acetic acid (PubChem CID 155962510) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylbenzoyl]-methylamino]acetic acid.
| Compound Name | 2-[[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylbenzoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 155962510 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]sulfonylbenzoyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1cccc(S(=O)(=O)N=S(C)(C)=O)c1 |
| InChI | InChI=1S/C12H16N2O6S2/c1-14(8-11(15)16)12(17)9-5-4-6-10(7-9)22(19,20)13-21(2,3)18/h4-7H,8H2,1-3H3,(H,15,16) |
| InChIKey | GHNNOWNIMPMULQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |