C15H17N3O5 — CID 120513436
4-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]butanoic acid (PubChem CID 120513436) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]butanoic acid.
| Compound Name | 4-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120513436 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]butanoic acid |
| SMILES | CC1(c2cccc(C(=O)NCCCC(=O)O)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H17N3O5/c1-15(13(22)17-14(23)18-15)10-5-2-4-9(8-10)12(21)16-7-3-6-11(19)20/h2,4-5,8H,3,6-7H2,1H3,(H,16,21)(H,19,20)(H2,17,18,22,23) |
| InChIKey | BWOAANNWFQMAQF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|