About 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid
4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid (PubChem CID 129467405) has the molecular formula C15H17N3O5
and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid |
| PubChem CID | 129467405 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid |
| SMILES | C[C@@]1(c2ccc(C(=O)NCCCC(=O)O)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H17N3O5/c1-15(13(22)17-14(23)18-15)10-6-4-9(5-7-10)12(21)16-8-2-3-11(19)20/h4-7H,2-3,8H2,1H3,(H,16,21)(H,19,20)(H2,17,18,22,23)/t15-/m0/s1 |
| InChIKey | HLFHMPYJAQCORP-HNNXBMFYSA-N |
| XLogP | 0.34 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid?
The IUPAC name of 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid (CID 129467405) is 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid.
What is the SMILES notation for 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid?
The canonical SMILES for 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid is C[C@@]1(c2ccc(C(=O)NCCCC(=O)O)cc2)NC(=O)NC1=O.
What is the InChIKey of 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid?
The InChIKey is HLFHMPYJAQCORP-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H17N3O5/c1-15(13(22)17-14(23)18-15)10-6-4-9(5-7-10)12(21)16-8-2-3-11(19)20/h4-7H,2-3,8H2,1H3,(H,16,21)(H,19,20)(H2,17,18,22,23)/t15-/m0/s1.
What are the key properties of 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid?
4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid has a molecular weight of 319.32 g/mol, XLogP of 0.34, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzoyl]amino]butanoic acid is sourced from PubChem (CID 129467405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).