C17H21N3O5 — CID 119360981
(2S)-4-methyl-2-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]pentanoic acid (PubChem CID 119360981) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119360981 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2S)-4-methyl-2-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(C2(C)NC(=O)NC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c1-9(2)8-12(14(22)23)18-13(21)10-4-6-11(7-5-10)17(3)15(24)19-16(25)20-17/h4-7,9,12H,8H2,1-3H3,(H,18,21)(H,22,23)(H2,19,20,24,25)/t12-,17?/m0/s1 |
| InChIKey | QOAQEAOLXMNRLS-WHUIICBVSA-N |
| XLogP | 0.97 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|