C18H23N3O5 — CID 119190642
3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190642) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190642 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)c1ccc(C2(C)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H23N3O5/c1-11(2)10-21(9-8-14(22)23)15(24)12-4-6-13(7-5-12)18(3)16(25)19-17(26)20-18/h4-7,11H,8-10H2,1-3H3,(H,22,23)(H2,19,20,25,26) |
| InChIKey | AXCZCVDUVNXNDN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|