C12H16ClNO4 — CID 75418009
3-[(5-chlorofuran-2-carbonyl)-(2-methylpropyl)amino]propanoic acid (PubChem CID 75418009) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-[(5-chlorofuran-2-carbonyl)-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[(5-chlorofuran-2-carbonyl)-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 75418009 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-[(5-chlorofuran-2-carbonyl)-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H16ClNO4/c1-8(2)7-14(6-5-11(15)16)12(17)9-3-4-10(13)18-9/h3-4,8H,5-7H2,1-2H3,(H,15,16) |
| InChIKey | ATTCGOCSQQZHLX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |