C15H24BrNO2 — CID 60653081
5-bromo-N,N-bis(3-methylbutyl)furan-2-carboxamide (PubChem CID 60653081) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 5-bromo-N,N-bis(3-methylbutyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N,N-bis(3-methylbutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60653081 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-bromo-N,N-bis(3-methylbutyl)furan-2-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H24BrNO2/c1-11(2)7-9-17(10-8-12(3)4)15(18)13-5-6-14(16)19-13/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | AKESXPYEQBIFFC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |