C13H20BrNO2 — CID 3627667
5-bromo-N,N-dibutylfuran-2-carboxamide (PubChem CID 3627667) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 5-bromo-N,N-dibutylfuran-2-carboxamide.
| Compound Name | 5-bromo-N,N-dibutylfuran-2-carboxamide |
|---|---|
| PubChem CID | 3627667 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-bromo-N,N-dibutylfuran-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H20BrNO2/c1-3-5-9-15(10-6-4-2)13(16)11-7-8-12(14)17-11/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | DRJFFJDOFICLHJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |