C11H18N2O2 — CID 82344196
5-amino-N,N-dipropylfuran-2-carboxamide (PubChem CID 82344196) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-amino-N,N-dipropylfuran-2-carboxamide.
| Compound Name | 5-amino-N,N-dipropylfuran-2-carboxamide |
|---|---|
| PubChem CID | 82344196 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-amino-N,N-dipropylfuran-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(N)o1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-7-13(8-4-2)11(14)9-5-6-10(12)15-9/h5-6H,3-4,7-8,12H2,1-2H3 |
| InChIKey | ZBNPSHMQEOCIGM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |