C10H12N2O6 — CID 61006997
3-[ethyl-(5-nitrofuran-2-carbonyl)amino]propanoic acid (PubChem CID 61006997) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is 3-[ethyl-(5-nitrofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[ethyl-(5-nitrofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61006997 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-[ethyl-(5-nitrofuran-2-carbonyl)amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H12N2O6/c1-2-11(6-5-9(13)14)10(15)7-3-4-8(18-7)12(16)17/h3-4H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | OQRNVCMXMDCYJV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|