C9H6N4O4 — CID 3312705
N,N-bis(cyanomethyl)-5-nitrofuran-2-carboxamide (PubChem CID 3312705) has the molecular formula C9H6N4O4 and a molecular weight of 234.17 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 3312705 |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | N,N-bis(cyanomethyl)-5-nitrofuran-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H6N4O4/c10-3-5-12(6-4-11)9(14)7-1-2-8(17-7)13(15)16/h1-2H,5-6H2 |
| InChIKey | QRSZSGXTOGTXEN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|