C11H17N3O4 — CID 112689839
N,N-diethyl-2-[(5-nitrofuran-2-yl)methylamino]acetamide (PubChem CID 112689839) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is N,N-diethyl-2-[(5-nitrofuran-2-yl)methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(5-nitrofuran-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 112689839 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N,N-diethyl-2-[(5-nitrofuran-2-yl)methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNCc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H17N3O4/c1-3-13(4-2)10(15)8-12-7-9-5-6-11(18-9)14(16)17/h5-6,12H,3-4,7-8H2,1-2H3 |
| InChIKey | SMGLMNNVOOELKL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|