C10H12ClNO4 — CID 110836895
3-[(5-chlorofuran-2-carbonyl)-methylamino]butanoic acid (PubChem CID 110836895) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-[(5-chlorofuran-2-carbonyl)-methylamino]butanoic acid.
| Compound Name | 3-[(5-chlorofuran-2-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 110836895 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-[(5-chlorofuran-2-carbonyl)-methylamino]butanoic acid |
| SMILES | CC(CC(=O)O)N(C)C(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C10H12ClNO4/c1-6(5-9(13)14)12(2)10(15)7-3-4-8(11)16-7/h3-4,6H,5H2,1-2H3,(H,13,14) |
| InChIKey | UVNNXMKGVWREAE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |