C19H23N3O5 — CID 120544967
1-[[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544967) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544967 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1(c2ccc(C(=O)NCC3(C(=O)O)CCCCC3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H23N3O5/c1-18(15(24)21-17(27)22-18)13-7-5-12(6-8-13)14(23)20-11-19(16(25)26)9-3-2-4-10-19/h5-8H,2-4,9-11H2,1H3,(H,20,23)(H,25,26)(H2,21,22,24,27) |
| InChIKey | GFAUUSCVDFDIAH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|