C15H19ClN2O3 — CID 115443369
1-[[(6-chloropyridine-3-carbonyl)amino]methyl]cycloheptane-1-carboxylic acid (PubChem CID 115443369) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 1-[[(6-chloropyridine-3-carbonyl)amino]methyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[[(6-chloropyridine-3-carbonyl)amino]methyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 115443369 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[[(6-chloropyridine-3-carbonyl)amino]methyl]cycloheptane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCCC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H19ClN2O3/c16-12-6-5-11(9-17-12)13(19)18-10-15(14(20)21)7-3-1-2-4-8-15/h5-6,9H,1-4,7-8,10H2,(H,18,19)(H,20,21) |
| InChIKey | XBBMLBVXIIMFMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|