C19H23N3O3 — CID 120544737
1-[[(1-benzylpyrazole-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544737) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[[(1-benzylpyrazole-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(1-benzylpyrazole-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544737 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[[(1-benzylpyrazole-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H23N3O3/c23-17(20-14-19(18(24)25)9-5-2-6-10-19)16-11-21-22(13-16)12-15-7-3-1-4-8-15/h1,3-4,7-8,11,13H,2,5-6,9-10,12,14H2,(H,20,23)(H,24,25) |
| InChIKey | YGHQRUPUQSJICO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |