C14H19ClN4O3 — CID 119405592
N-(3-aminopropyl)-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide;hydrochloride (PubChem CID 119405592) has the molecular formula C14H19ClN4O3 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119405592 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(3-aminopropyl)-4-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide;hydrochloride |
| SMILES | CC1(c2ccc(C(=O)NCCCN)cc2)NC(=O)NC1=O.Cl |
| InChI | InChI=1S/C14H18N4O3.ClH/c1-14(12(20)17-13(21)18-14)10-5-3-9(4-6-10)11(19)16-8-2-7-15;/h3-6H,2,7-8,15H2,1H3,(H,16,19)(H2,17,18,20,21);1H |
| InChIKey | NUWHPCDWQAOKJQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|