C22H22N4O4 — CID 154872827
5-acetyl-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-1,3-dihydroisoindole-2-carboxamide (PubChem CID 154872827) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 5-acetyl-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | 5-acetyl-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 154872827 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-acetyl-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-1,3-dihydroisoindole-2-carboxamide |
| SMILES | CC(=O)c1ccc2c(c1)CN(C(=O)NCc1cccc(C3(C)NC(=O)NC3=O)c1)C2 |
| InChI | InChI=1S/C22H22N4O4/c1-13(27)15-6-7-16-11-26(12-17(16)9-15)21(30)23-10-14-4-3-5-18(8-14)22(2)19(28)24-20(29)25-22/h3-9H,10-12H2,1-2H3,(H,23,30)(H2,24,25,28,29) |
| InChIKey | QUPYCBGEBNWHLW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|