C23H23N5O4 — CID 154840618
N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide (PubChem CID 154840618) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 154840618 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
| SMILES | CC1(c2cccc(CNC(=O)N3CCC4(C3)C(=O)Nc3ccccc34)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H23N5O4/c1-22(18(29)26-20(31)27-22)15-6-4-5-14(11-15)12-24-21(32)28-10-9-23(13-28)16-7-2-3-8-17(16)25-19(23)30/h2-8,11H,9-10,12-13H2,1H3,(H,24,32)(H,25,30)(H2,26,27,29,31) |
| InChIKey | MNVUNHDKVIHGSD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|