C24H24ClN5O4 — CID 154833714
4-(5-chloro-1,3-benzoxazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 154833714) has the molecular formula C24H24ClN5O4 and a molecular weight of 481.94 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzoxazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 4-(5-chloro-1,3-benzoxazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154833714 |
| Molecular Formula | C24H24ClN5O4 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 4-(5-chloro-1,3-benzoxazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | CC1(c2cccc(CNC(=O)N3CCC(c4nc5cc(Cl)ccc5o4)CC3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H24ClN5O4/c1-24(21(31)28-22(32)29-24)16-4-2-3-14(11-16)13-26-23(33)30-9-7-15(8-10-30)20-27-18-12-17(25)5-6-19(18)34-20/h2-6,11-12,15H,7-10,13H2,1H3,(H,26,33)(H2,28,29,31,32) |
| InChIKey | CKTSXRDDVNHTGB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|