C24H24N4O4 — CID 146129813
5-methyl-5-[3-[4-(7-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 146129813) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-methyl-5-[3-[4-(7-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[3-[4-(7-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146129813 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-methyl-5-[3-[4-(7-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc2nc(C3CCN(C(=O)c4cccc(C5(C)NC(=O)NC5=O)c4)CC3)oc12 |
| InChI | InChI=1S/C24H24N4O4/c1-14-5-3-8-18-19(14)32-20(25-18)15-9-11-28(12-10-15)21(29)16-6-4-7-17(13-16)24(2)22(30)26-23(31)27-24/h3-8,13,15H,9-12H2,1-2H3,(H2,26,27,30,31) |
| InChIKey | WPIWXQOHQGHKGI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|