C24H23FN4O4 — CID 134495094
(5R)-5-[3-fluoro-4-[4-(6-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 134495094) has the molecular formula C24H23FN4O4 and a molecular weight of 450.47 g/mol. Its IUPAC name is (5R)-5-[3-fluoro-4-[4-(6-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-fluoro-4-[4-(6-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134495094 |
| Molecular Formula | C24H23FN4O4 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (5R)-5-[3-fluoro-4-[4-(6-methyl-1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1ccc2nc(C3CCN(C(=O)c4ccc([C@@]5(C)NC(=O)NC5=O)cc4F)CC3)oc2c1 |
| InChI | InChI=1S/C24H23FN4O4/c1-13-3-6-18-19(11-13)33-20(26-18)14-7-9-29(10-8-14)21(30)16-5-4-15(12-17(16)25)24(2)22(31)27-23(32)28-24/h3-6,11-12,14H,7-10H2,1-2H3,(H2,27,28,31,32)/t24-/m1/s1 |
| InChIKey | NLNVXKULPWJKFP-XMMPIXPASA-N |
| XLogP | 3.35 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|