C24H29N5O3 — CID 134494886
5-methyl-5-[3-methyl-4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 134494886) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-methyl-5-[3-methyl-4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[3-methyl-4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494886 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 5-methyl-5-[3-methyl-4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C2(C)NC(=O)NC2=O)ccc1C(=O)N1CCN(c2nc(C)c(C)cc2C)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-14-12-16(3)20(25-17(14)4)28-8-10-29(11-9-28)21(30)19-7-6-18(13-15(19)2)24(5)22(31)26-23(32)27-24/h6-7,12-13H,8-11H2,1-5H3,(H2,26,27,31,32) |
| InChIKey | ZQWUZCKXGOOTFC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|