C22H24FN5O3 — CID 134494483
5-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-2-fluorophenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 134494483) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 5-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-2-fluorophenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-2-fluorophenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494483 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-2-fluorophenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cnc(N2CCN(C(=O)c3ccc(C4(C)NC(=O)NC4=O)c(F)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H24FN5O3/c1-13-10-14(2)18(24-12-13)27-6-8-28(9-7-27)19(29)15-4-5-16(17(23)11-15)22(3)20(30)25-21(31)26-22/h4-5,10-12H,6-9H2,1-3H3,(H2,25,26,30,31) |
| InChIKey | DOOBBVLTDNAJGU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|