4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid

C12H17N3O2 — CID 141315989

IUPAC4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid
SMILESCc1cnc(N2CCN(C(=O)O)CC2)c(C)c1
InChIInChI=1S/C12H17N3O2/c1-9-7-10(2)11(13-8-9)14-3-5-15(6-4-14)12(16)17/h7-8H,3-6H2,1-2H3,(H,16,17)
InChIKeyISQFYGOZBQORGF-UHFFFAOYSA-N
MW235.29 g/mol
LogP1.50
Rot. Bonds1

About 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid

4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid (PubChem CID 141315989) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid.

Molecular Properties

Compound Name4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid
PubChem CID141315989
Molecular FormulaC12H17N3O2
Molecular Weight235.29 g/mol
Exact Mass235.13
IUPAC Name4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid
SMILESCc1cnc(N2CCN(C(=O)O)CC2)c(C)c1
InChIInChI=1S/C12H17N3O2/c1-9-7-10(2)11(13-8-9)14-3-5-15(6-4-14)12(16)17/h7-8H,3-6H2,1-2H3,(H,16,17)
InChIKeyISQFYGOZBQORGF-UHFFFAOYSA-N
XLogP1.50
TPSA56.67 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.29
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid?
The IUPAC name of 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid (CID 141315989) is 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid.
What is the SMILES notation for 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid?
The canonical SMILES for 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid is Cc1cnc(N2CCN(C(=O)O)CC2)c(C)c1.
What is the InChIKey of 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid?
The InChIKey is ISQFYGOZBQORGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-9-7-10(2)11(13-8-9)14-3-5-15(6-4-14)12(16)17/h7-8H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid?
4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid has a molecular weight of 235.29 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carboxylic acid is sourced from PubChem (CID 141315989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).