C18H21FN4O — CID 71252935
[4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(6-fluoro-4-methyl-3-pyridinyl)methanone (PubChem CID 71252935) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(6-fluoro-4-methyl-3-pyridinyl)methanone.
| Compound Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(6-fluoro-4-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 71252935 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(6-fluoro-4-methyl-3-pyridinyl)methanone |
| SMILES | Cc1cnc(N2CCN(C(=O)c3cnc(F)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C18H21FN4O/c1-12-8-14(3)17(21-10-12)22-4-6-23(7-5-22)18(24)15-11-20-16(19)9-13(15)2/h8-11H,4-7H2,1-3H3 |
| InChIKey | YRTRMSSSTWAKOO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|