C18H19FIN3O — CID 71252432
[4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(2-fluoro-4-iodophenyl)methanone (PubChem CID 71252432) has the molecular formula C18H19FIN3O and a molecular weight of 439.27 g/mol. Its IUPAC name is [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(2-fluoro-4-iodophenyl)methanone.
| Compound Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(2-fluoro-4-iodophenyl)methanone |
|---|---|
| PubChem CID | 71252432 |
| Molecular Formula | C18H19FIN3O |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-(2-fluoro-4-iodophenyl)methanone |
| SMILES | Cc1cnc(N2CCN(C(=O)c3ccc(I)cc3F)CC2)c(C)c1 |
| InChI | InChI=1S/C18H19FIN3O/c1-12-9-13(2)17(21-11-12)22-5-7-23(8-6-22)18(24)15-4-3-14(20)10-16(15)19/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | QUIIDPKRHPIZKJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|