C22H24FN5O3 — CID 71252581
1-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-3-fluorophenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 71252581) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 1-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-3-fluorophenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 1-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-3-fluorophenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71252581 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[4-[4-(3,5-dimethyl-2-pyridinyl)piperazine-1-carbonyl]-3-fluorophenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cnc(N2CCN(C(=O)c3ccc(N4C(=O)NC(=O)C4C)cc3F)CC2)c(C)c1 |
| InChI | InChI=1S/C22H24FN5O3/c1-13-10-14(2)19(24-12-13)26-6-8-27(9-7-26)21(30)17-5-4-16(11-18(17)23)28-15(3)20(29)25-22(28)31/h4-5,10-12,15H,6-9H2,1-3H3,(H,25,29,31) |
| InChIKey | ZEQAWOAQRVHKEA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|