C18H19BrFN3O — CID 133359775
[4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-(3-fluoro-4-methylphenyl)methanone (PubChem CID 133359775) has the molecular formula C18H19BrFN3O and a molecular weight of 392.27 g/mol. Its IUPAC name is [4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-(3-fluoro-4-methylphenyl)methanone.
| Compound Name | [4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-(3-fluoro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 133359775 |
| Molecular Formula | C18H19BrFN3O |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-(3-fluoro-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ncc(Br)cc3C)CC2)cc1F |
| InChI | InChI=1S/C18H19BrFN3O/c1-12-3-4-14(10-16(12)20)18(24)23-7-5-22(6-8-23)17-13(2)9-15(19)11-21-17/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | ICPFFURWFWLDKF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |