C19H18BrFN2O2 — CID 55878769
(3-bromophenyl)-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]methanone (PubChem CID 55878769) has the molecular formula C19H18BrFN2O2 and a molecular weight of 405.27 g/mol. Its IUPAC name is (3-bromophenyl)-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55878769 |
| Molecular Formula | C19H18BrFN2O2 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (3-bromophenyl)-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1F |
| InChI | InChI=1S/C19H18BrFN2O2/c1-13-5-6-15(12-17(13)21)19(25)23-9-7-22(8-10-23)18(24)14-3-2-4-16(20)11-14/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | FLXTVDSXHAWZNF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |