C17H14F5N3O — CID 133371548
(3-fluoro-4-methylphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone (PubChem CID 133371548) has the molecular formula C17H14F5N3O and a molecular weight of 371.31 g/mol. Its IUPAC name is (3-fluoro-4-methylphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (3-fluoro-4-methylphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 133371548 |
| Molecular Formula | C17H14F5N3O |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3-fluoro-4-methylphenyl)-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(c3c(F)c(F)nc(F)c3F)CC2)cc1F |
| InChI | InChI=1S/C17H14F5N3O/c1-9-2-3-10(8-11(9)18)17(26)25-6-4-24(5-7-25)14-12(19)15(21)23-16(22)13(14)20/h2-3,8H,4-7H2,1H3 |
| InChIKey | USBZSGZHSNWRBV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|