C19H19ClFN3O2 — CID 47049586
N-(4-chlorophenyl)-4-(3-fluoro-4-methylbenzoyl)piperazine-1-carboxamide (PubChem CID 47049586) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(3-fluoro-4-methylbenzoyl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(3-fluoro-4-methylbenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47049586 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-(3-fluoro-4-methylbenzoyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)Nc3ccc(Cl)cc3)CC2)cc1F |
| InChI | InChI=1S/C19H19ClFN3O2/c1-13-2-3-14(12-17(13)21)18(25)23-8-10-24(11-9-23)19(26)22-16-6-4-15(20)5-7-16/h2-7,12H,8-11H2,1H3,(H,22,26) |
| InChIKey | GWBMIXNMXHFKRG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |