C17H18ClN3O3 — CID 75370481
N-(4-chlorophenyl)-4-(3-methylfuran-2-carbonyl)piperazine-1-carboxamide (PubChem CID 75370481) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(3-methylfuran-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(3-methylfuran-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 75370481 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(4-chlorophenyl)-4-(3-methylfuran-2-carbonyl)piperazine-1-carboxamide |
| SMILES | Cc1ccoc1C(=O)N1CCN(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-12-6-11-24-15(12)16(22)20-7-9-21(10-8-20)17(23)19-14-4-2-13(18)3-5-14/h2-6,11H,7-10H2,1H3,(H,19,23) |
| InChIKey | SQPZLJOJABOEGR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |