C20H22ClFN2O3 — CID 42360371
N-(3-chloro-4-fluorophenyl)-3-[1-(3-methylfuran-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 42360371) has the molecular formula C20H22ClFN2O3 and a molecular weight of 392.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[1-(3-methylfuran-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[1-(3-methylfuran-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 42360371 |
| Molecular Formula | C20H22ClFN2O3 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[1-(3-methylfuran-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | Cc1ccoc1C(=O)N1CCC(CCC(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22ClFN2O3/c1-13-8-11-27-19(13)20(26)24-9-6-14(7-10-24)2-5-18(25)23-15-3-4-17(22)16(21)12-15/h3-4,8,11-12,14H,2,5-7,9-10H2,1H3,(H,23,25) |
| InChIKey | RIFPZZBAGDWSRI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |