C18H24ClFN2OS — CID 56856067
N-(3-chloro-4-fluorophenyl)-3-[1-(thiolan-3-yl)piperidin-4-yl]propanamide (PubChem CID 56856067) has the molecular formula C18H24ClFN2OS and a molecular weight of 370.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[1-(thiolan-3-yl)piperidin-4-yl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[1-(thiolan-3-yl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 56856067 |
| Molecular Formula | C18H24ClFN2OS |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[1-(thiolan-3-yl)piperidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCN(C2CCSC2)CC1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H24ClFN2OS/c19-16-11-14(2-3-17(16)20)21-18(23)4-1-13-5-8-22(9-6-13)15-7-10-24-12-15/h2-3,11,13,15H,1,4-10,12H2,(H,21,23) |
| InChIKey | ANGOXLLFDQPBRI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |