C17H22ClFN2O2S — CID 25451687
N-(3-chloro-4-fluorophenyl)-3-[1-(2-methylsulfanylacetyl)piperidin-4-yl]propanamide (PubChem CID 25451687) has the molecular formula C17H22ClFN2O2S and a molecular weight of 372.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[1-(2-methylsulfanylacetyl)piperidin-4-yl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[1-(2-methylsulfanylacetyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 25451687 |
| Molecular Formula | C17H22ClFN2O2S |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[1-(2-methylsulfanylacetyl)piperidin-4-yl]propanamide |
| SMILES | CSCC(=O)N1CCC(CCC(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22ClFN2O2S/c1-24-11-17(23)21-8-6-12(7-9-21)2-5-16(22)20-13-3-4-15(19)14(18)10-13/h3-4,10,12H,2,5-9,11H2,1H3,(H,20,22) |
| InChIKey | HZPVFOGDJVWHOG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |