C19H27ClN2OS — CID 56707250
N-(2-chlorophenyl)-3-[1-(thian-4-yl)piperidin-4-yl]propanamide (PubChem CID 56707250) has the molecular formula C19H27ClN2OS and a molecular weight of 366.96 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[1-(thian-4-yl)piperidin-4-yl]propanamide.
| Compound Name | N-(2-chlorophenyl)-3-[1-(thian-4-yl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 56707250 |
| Molecular Formula | C19H27ClN2OS |
| Molecular Weight | 366.96 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(2-chlorophenyl)-3-[1-(thian-4-yl)piperidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCN(C2CCSCC2)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN2OS/c20-17-3-1-2-4-18(17)21-19(23)6-5-15-7-11-22(12-8-15)16-9-13-24-14-10-16/h1-4,15-16H,5-14H2,(H,21,23) |
| InChIKey | VDMWADZGHODMQV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.96 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |