C18H27ClN2OS — CID 42565370
N-(2-chlorophenyl)-3-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]propanamide (PubChem CID 42565370) has the molecular formula C18H27ClN2OS and a molecular weight of 354.95 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]propanamide.
| Compound Name | N-(2-chlorophenyl)-3-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 42565370 |
| Molecular Formula | C18H27ClN2OS |
| Molecular Weight | 354.95 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(2-chlorophenyl)-3-[1-[(2S)-1-methylsulfanylpropan-2-yl]piperidin-4-yl]propanamide |
| SMILES | CSC[C@H](C)N1CCC(CCC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H27ClN2OS/c1-14(13-23-2)21-11-9-15(10-12-21)7-8-18(22)20-17-6-4-3-5-16(17)19/h3-6,14-15H,7-13H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | VZZRQVYHPTUWFU-AWEZNQCLSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |