C17H20N2O2 — CID 110695645
(4-benzylpiperazin-1-yl)-(3-methylfuran-2-yl)methanone (PubChem CID 110695645) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(3-methylfuran-2-yl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 110695645 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H20N2O2/c1-14-7-12-21-16(14)17(20)19-10-8-18(9-11-19)13-15-5-3-2-4-6-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | CRBZGEOSAGIOKV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |