C17H22FN3O4 — CID 122021551
4-[[4-(3-fluoro-4-methylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid (PubChem CID 122021551) has the molecular formula C17H22FN3O4 and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-[[4-(3-fluoro-4-methylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(3-fluoro-4-methylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021551 |
| Molecular Formula | C17H22FN3O4 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[[4-(3-fluoro-4-methylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)NCCCC(=O)O)CC2)cc1F |
| InChI | InChI=1S/C17H22FN3O4/c1-12-4-5-13(11-14(12)18)16(24)20-7-9-21(10-8-20)17(25)19-6-2-3-15(22)23/h4-5,11H,2-3,6-10H2,1H3,(H,19,25)(H,22,23) |
| InChIKey | RORCULFFMJZIAC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|