C18H25N3O4 — CID 122021576
4-[[4-(4-ethylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid (PubChem CID 122021576) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[[4-(4-ethylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(4-ethylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021576 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-[[4-(4-ethylbenzoyl)piperazine-1-carbonyl]amino]butanoic acid |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)NCCCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-2-14-5-7-15(8-6-14)17(24)20-10-12-21(13-11-20)18(25)19-9-3-4-16(22)23/h5-8H,2-4,9-13H2,1H3,(H,19,25)(H,22,23) |
| InChIKey | QAIPSASWUJUCQM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|