C25H40N6O9 — CID 144538673
6-[[4-(4-aminobenzoyl)piperazine-1-carbonyl]amino]hexanoic acid;4-(carbamoylamino)pentanoic acid;formic acid (PubChem CID 144538673) has the molecular formula C25H40N6O9 and a molecular weight of 568.63 g/mol. Its IUPAC name is 6-[[4-(4-aminobenzoyl)piperazine-1-carbonyl]amino]hexanoic acid;4-(carbamoylamino)pentanoic acid;formic acid.
| Compound Name | 6-[[4-(4-aminobenzoyl)piperazine-1-carbonyl]amino]hexanoic acid;4-(carbamoylamino)pentanoic acid;formic acid |
|---|---|
| PubChem CID | 144538673 |
| Molecular Formula | C25H40N6O9 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 6-[[4-(4-aminobenzoyl)piperazine-1-carbonyl]amino]hexanoic acid;4-(carbamoylamino)pentanoic acid;formic acid |
| SMILES | CC(CCC(=O)O)NC(N)=O.Nc1ccc(C(=O)N2CCN(C(=O)NCCCCCC(=O)O)CC2)cc1.O=CO |
| InChI | InChI=1S/C18H26N4O4.C6H12N2O3.CH2O2/c19-15-7-5-14(6-8-15)17(25)21-10-12-22(13-11-21)18(26)20-9-3-1-2-4-16(23)24;1-4(8-6(7)11)2-3-5(9)10;2-1-3/h5-8H,1-4,9-13,19H2,(H,20,26)(H,23,24);4H,2-3H2,1H3,(H,9,10)(H3,7,8,11);1H,(H,2,3) |
| InChIKey | LSPRPDQSQSOYMI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 245.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|