C25H31F2N3O3 — CID 175151385
7-[[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid (PubChem CID 175151385) has the molecular formula C25H31F2N3O3 and a molecular weight of 459.54 g/mol. Its IUPAC name is 7-[[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid.
| Compound Name | 7-[[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 175151385 |
| Molecular Formula | C25H31F2N3O3 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 7-[[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H31F2N3O3/c26-21-10-6-19(7-11-21)24(20-8-12-22(27)13-9-20)29-15-17-30(18-16-29)25(33)28-14-4-2-1-3-5-23(31)32/h6-13,24H,1-5,14-18H2,(H,28,33)(H,31,32) |
| InChIKey | MAUNLCFTRVCQGE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|