C17H24FNO3 — CID 119227583
7-[3-(4-fluorophenyl)butanoylamino]heptanoic acid (PubChem CID 119227583) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 7-[3-(4-fluorophenyl)butanoylamino]heptanoic acid.
| Compound Name | 7-[3-(4-fluorophenyl)butanoylamino]heptanoic acid |
|---|---|
| PubChem CID | 119227583 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 7-[3-(4-fluorophenyl)butanoylamino]heptanoic acid |
| SMILES | CC(CC(=O)NCCCCCCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNO3/c1-13(14-7-9-15(18)10-8-14)12-16(20)19-11-5-3-2-4-6-17(21)22/h7-10,13H,2-6,11-12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | XTTYWNKMYGJZMI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|