C24H32N8O9 — CID 155338484
2-[[5-[[4-(4-azidobenzoyl)piperazine-1-carbonyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 155338484) has the molecular formula C24H32N8O9 and a molecular weight of 576.57 g/mol. Its IUPAC name is 2-[[5-[[4-(4-azidobenzoyl)piperazine-1-carbonyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-[[4-(4-azidobenzoyl)piperazine-1-carbonyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 155338484 |
| Molecular Formula | C24H32N8O9 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2-[[5-[[4-(4-azidobenzoyl)piperazine-1-carbonyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)N2CCN(C(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C24H32N8O9/c25-30-29-16-6-4-15(5-7-16)20(35)31-11-13-32(14-12-31)24(41)26-10-2-1-3-17(21(36)37)27-23(40)28-18(22(38)39)8-9-19(33)34/h4-7,17-18H,1-3,8-14H2,(H,26,41)(H,33,34)(H,36,37)(H,38,39)(H2,27,28,40) |
| InChIKey | ZUXOTTDMNMRMLD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 254.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|