C23H32N6O8 — CID 155338461
2-[[[5-[4-(4-azidophenyl)butanoylamino]-1-carboxypentyl]-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 155338461) has the molecular formula C23H32N6O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-[[[5-[4-(4-azidophenyl)butanoylamino]-1-carboxypentyl]-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | 2-[[[5-[4-(4-azidophenyl)butanoylamino]-1-carboxypentyl]-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 155338461 |
| Molecular Formula | C23H32N6O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-[[[5-[4-(4-azidophenyl)butanoylamino]-1-carboxypentyl]-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | CN(C(=O)NC(CCC(=O)O)C(=O)O)C(CCCCNC(=O)CCCc1ccc(N=[N+]=[N-])cc1)C(=O)O |
| InChI | InChI=1S/C23H32N6O8/c1-29(23(37)26-17(21(33)34)12-13-20(31)32)18(22(35)36)6-2-3-14-25-19(30)7-4-5-15-8-10-16(11-9-15)27-28-24/h8-11,17-18H,2-7,12-14H2,1H3,(H,25,30)(H,26,37)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | UFBAFUJIPZNRET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 222.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|